4-Oxododecanedioic acid manufacturers
|
| | 4-Oxododecanedioic acid Basic information |
| | 4-Oxododecanedioic acid Chemical Properties |
| Melting point | 106-109 °C(Solv: ethyl ether (60-29-7)) | | Boiling point | 472.4±25.0 °C(Predicted) | | density | 1.146±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.77±0.17(Predicted) | | InChI | InChI=1S/C12H20O5/c13-10(8-9-12(16)17)6-4-2-1-3-5-7-11(14)15/h1-9H2,(H,14,15)(H,16,17) | | InChIKey | HHXMOTDTSDYYEI-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCC(=O)CCCCCCCC(O)=O |
| | 4-Oxododecanedioic acid Usage And Synthesis |
| Uses | 4-Oxododecanedioic acid is a fatty acid derivative[1]. | | Definition | ChEBI: 4-oxododecanedioic acid is an oxo carboxylic acid. | | References | [1] Javier Rivero, et al. Mycorrhizal symbiosis primes the accumulation of antiherbivore compounds and enhances herbivore mortality in tomato. J Exp Bot. 2021 Jun 22;72(13):5038-5050. DOI:10.1093/jxb/erab171 |
| | 4-Oxododecanedioic acid Preparation Products And Raw materials |
|