| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3-(Methoxymethoxy)benzaldehyde manufacturers
|
| | 3-(Methoxymethoxy)benzaldehyde Basic information |
| | 3-(Methoxymethoxy)benzaldehyde Chemical Properties |
| Boiling point | 98 °C(Press: 1 Torr) | | density | 1.14 | | refractive index | 1.5310 to 1.5350 | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C9H10O3/c1-11-7-12-9-4-2-3-8(5-9)6-10/h2-6H,7H2,1H3 | | InChIKey | JAFJNSQISURLCX-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=CC(OCOC)=C1 |
| Hazard Codes | Xi | | Risk Statements | 36-52 | | Safety Statements | 26 | | HS Code | 2912490090 |
| | 3-(Methoxymethoxy)benzaldehyde Usage And Synthesis |
| Uses | 3-(Methoxymethoxy)benzaldehyde is used as a reagent in the synthesis of novel millepachine derivatives as potent antiproliferative agents. Also used as a reagent in the synthesis of pyranochalcone derivatives as potent anti-inflammatory agents. |
| | 3-(Methoxymethoxy)benzaldehyde Preparation Products And Raw materials |
|