|
|
| | Methyl 4-(4-hydroxybutyl)benzoate Basic information | | Appearance |
| Product Name: | Methyl 4-(4-hydroxybutyl)benzoate | | Synonyms: | 4-(4-Hydroxybutyl)benzoic acid Methyl ester;Methyl 4-(4-hydroxybut-1-yl)benzoate;BENZOIC ACID, 4-(4-HYDROXYBUTYL)-, METHYL ESTER;(4-Hydroxybutyl)benzoic acid methyl ester;Benzoic acid, 4-(4-hydroxybutyl)-, methyl ester (9CI, ACI);4-(4-hydroxybutyl)-Benzoic acid methyl ester (9CI ACI);methyl 4-(4-hydroxybutyl)benzoate;4-(4-HydroxyButyl)Benzoic acid methyl ester pemetrexed disodium intermediate | | CAS: | 123910-88-3 | | MF: | C12H16O3 | | MW: | 208.25 | | EINECS: | | | Product Categories: | Aromatics;Intermediates;Aromatics, Intermediates | | Mol File: | 123910-88-3.mol |  |
| | Methyl 4-(4-hydroxybutyl)benzoate Chemical Properties |
| Boiling point | 343.6±35.0 °C(Predicted) | | density | 1.092±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | pka | 15.12±0.10(Predicted) | | form | Oil | | color | Colourless to Light Yellow | | InChI | InChI=1S/C12H16O3/c1-15-12(14)11-7-5-10(6-8-11)4-2-3-9-13/h5-8,13H,2-4,9H2,1H3 | | InChIKey | KVKWRSNRAXOBFC-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(CCCCO)C=C1 |
| | Methyl 4-(4-hydroxybutyl)benzoate Usage And Synthesis |
| Appearance | Colourless to light yellow oil | | Uses | 4-(4-Hydroxybutyl)benzoic Acid Methyl Ester is a benzoic acid derivative used in the preparation of yrrolo[2,3-d]pyrimidine-based antitumor agents as well as other biologically active compounds. | | Synthesis | Methyl 4-(4-hydroxybutyl)benzoate was prepared through reaction using Methyl 4-(3-hydroxypropyl)benzoate (1.45 g, 7.4 mmol) as the starting material, yielding a transparent oily liquid. |
| | Methyl 4-(4-hydroxybutyl)benzoate Preparation Products And Raw materials |
|