|
|
| | 4,5-Dibromopyridazin-3-one Basic information |
| Product Name: | 4,5-Dibromopyridazin-3-one | | Synonyms: | 4,5-Dibromo-3[2H]-pyridazone;4,5-DIBROMOPYRIDAZIN-3[2H]-ONE;N'-(5-bromo-2-oxo-3-indolyl)-1-naphthalenesulfonohydrazide;4,5-Dibromo-3(2H)-pyridazinon;4,5-DIBROMOPYRIDAZIN-3-ONE;4,5-DIBROMO-3(2H)-PYRIDAZINONE;4,5-DIBROMO-2H-PYRIDAZIN-3-ONE;4,5-Dibromo-3-pyridazone | | CAS: | 5788-58-9 | | MF: | C4H2Br2N2O | | MW: | 253.88 | | EINECS: | | | Product Categories: | | | Mol File: | 5788-58-9.mol |  |
| | 4,5-Dibromopyridazin-3-one Chemical Properties |
| Melting point | 231-233°C | | density | 2.53±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 8.39±0.60(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light orange | | BRN | 121469 | | InChI | InChI=1S/C4H2Br2N2O/c5-2-1-7-8-4(9)3(2)6/h1H,(H,8,9) | | InChIKey | AGLQURQNVJVJNB-UHFFFAOYSA-N | | SMILES | C1(=O)NN=CC(Br)=C1Br | | CAS DataBase Reference | 5788-58-9(CAS DataBase Reference) | | NIST Chemistry Reference | 4,5-Dibromo-3(2h)-pyridazinone(5788-58-9) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HazardClass | IRRITANT | | HS Code | 2933998090 |
| Provider | Language |
|
ALFA
| English |
| | 4,5-Dibromopyridazin-3-one Usage And Synthesis |
| Uses | 4,5-Dibromo-3(2H)-pyridazinone is used as an intermediate in the manufacture of pharmaceuticals. It is widely used in chemical research and in fine chemicals. |
| | 4,5-Dibromopyridazin-3-one Preparation Products And Raw materials |
|