| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Androstene-3,17-dione-2,3,4-13C3 manufacturers
|
| | Androstene-3,17-dione-2,3,4-13C3 Basic information |
| Product Name: | Androstene-3,17-dione-2,3,4-13C3 | | Synonyms: | Androstene-3,17-dione-2,3,4-13C3;Androst-4-ene-3,17-dione-[13C3];Androst-4-ene-3,17-dione-[13C3] (CertiMass solution);Androstene-3,17-dione-2,3,4-13C3 solution;4-ANDROSTENE-3,17-DIONE (2,3,4-13C3,98%) 100 UG/ML IN METHANOL;Androst-4-ene-3,17-dione-[13C3] (Solution);4-ANDROSTENE-3,17-DIONE (2,3,4-13C3, 98%+);4-Androstene-3,17-Dione (2,3,4-13C3) | | CAS: | 327048-86-2 | | MF: | C19H26O2 | | MW: | 289.39 | | EINECS: | 200-835-2 | | Product Categories: | | | Mol File: | 327048-86-2.mol |  |
| | Androstene-3,17-dione-2,3,4-13C3 Chemical Properties |
| density | 1.119±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Fp | 2℃ | | storage temp. | -20°C | | form | solution | | Major Application | clinical testing | | InChI | 1S/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-16H,3-10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1/i7+1,11+1,13+1 | | InChIKey | AEMFNILZOJDQLW-FZIFMXJCSA-N | | SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=[13CH][13C](=O)[13CH2]C[C@]34C)[C@@H]1CCC2=O | | CAS Number Unlabeled | 63-05-8 |
| Hazard Codes | F,Xn | | Risk Statements | 11-20/21/22-36 | | Safety Statements | 16-36/37 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
| | Androstene-3,17-dione-2,3,4-13C3 Usage And Synthesis |
| Uses | This product may be used as an analytical standard. |
| | Androstene-3,17-dione-2,3,4-13C3 Preparation Products And Raw materials |
| Raw materials | Cyclopenta[5,6]naphtho[1,2-c]pyran-2(4H)-one, 4a,4b,5,6,6a,7,8,9,9a,9b,10,11-dodecahydro-7-hydroxy-4a,6a-dimethyl-, (4aR,4bS,6aS,7S,9aS,9bR)- |
|