|
|
| | 2,5-diMethoxy-4-PyriMidinaMine Basic information |
| Product Name: | 2,5-diMethoxy-4-PyriMidinaMine | | Synonyms: | 2,5-diMethoxy-4-PyriMidinaMine;NSC 69792;2,5-DiMethoxy-4-aMinopyriMidine;2,5-Dimethoxypyrimidin-4-amine;4-Pyrimidinamine, 2,5-dimethoxy-;2,5-diMethoxy-4-PyriMidinaMine ISO 9001：2015 REACH;2,5-Dimethoxy-pyrimidin-4-ylamine | | CAS: | 6960-17-4 | | MF: | C6H9N3O2 | | MW: | 155.15 | | EINECS: | | | Product Categories: | | | Mol File: | 6960-17-4.mol |  |
| | 2,5-diMethoxy-4-PyriMidinaMine Chemical Properties |
| Melting point | 180-181℃ (water ) | | Boiling point | 316.2±45.0 °C(Predicted) | | density | 1.229±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 5.06±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H9N3O2/c1-10-4-3-8-6(11-2)9-5(4)7/h3H,1-2H3,(H2,7,8,9) | | InChIKey | XOJPOIGPYBYDJF-UHFFFAOYSA-N | | SMILES | C1(OC)=NC=C(OC)C(N)=N1 | | EPA Substance Registry System | 4-Pyrimidinamine, 2,5-dimethoxy- (6960-17-4) |
| | 2,5-diMethoxy-4-PyriMidinaMine Usage And Synthesis |
| Chemical Properties | White to light yellow crystalline powder |
| | 2,5-diMethoxy-4-PyriMidinaMine Preparation Products And Raw materials |
|