|
|
| | Myricetin 3-O-galactoside Basic information |
| Product Name: | Myricetin 3-O-galactoside | | Synonyms: | Myricetin 3-O-galactoside;Myricetin 3-O-beta-galactopyranoside;myricetin 3-O-beta-L-galactopyranoside;4H-1-Benzopyran-4-one,3-(b-D-galactopyranosyloxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-;4H-1-Benzopyran-4-one, 3-(β-D-galactopyranosyloxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-;Myricetin 3-O-beta-D-Galactopyranoside >=85% (LC/MS-ELSD);myricetin3-O-β-L-galactopyranoside;Myricetin 3-O-galactoside, 10 mM in DMSO | | CAS: | 15648-86-9 | | MF: | C21H20O13 | | MW: | 480.38 | | EINECS: | | | Product Categories: | | | Mol File: | 15648-86-9.mol |  |
| | Myricetin 3-O-galactoside Chemical Properties |
| Melting point | 196-198 °C | | Boiling point | 957.8±65.0 °C(Predicted) | | density | 1.96±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Acetone: soluble,Chloroform: soluble,Dichloromethane: soluble,DMSO: soluble,Ethyl Acetate: soluble | | form | A solid | | pka | 6.16±0.40(Predicted) | | color | White to off-white | | Major Application | food and beverages
pharmaceutical | | InChIKey | FOHXFLPXBUAOJM-MGMURXEASA-N | | SMILES | OC[C@H]1O[C@@H](OC2=C(Oc3cc(O)cc(O)c3C2=O)c4cc(O)c(O)c(O)c4)[C@H](O)[C@@H](O)[C@H]1O | | LogP | 1.560 (est) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Myricetin 3-O-galactoside Usage And Synthesis |
| Uses | metabolomics
vitamins, nutraceuticals, and natural products | | Definition | ChEBI: A glycosyloxyflavone that is myricetin with a beta-L-galactosyl residue attached at position 3. | | General Description | Natural product derived from plant source. |
| | Myricetin 3-O-galactoside Preparation Products And Raw materials |
|