| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N,N-Bis(3-chlorobenzyl)amine Basic information |
| Product Name: | N,N-Bis(3-chlorobenzyl)amine | | Synonyms: | BIS(3-CHLOROBENZYL)AMINE;Benzenemethanamine, 3-chloro-N-[(3-chlorophenyl)methyl]-;N-(3-chlorobenzyl)(3-chlorophenyl)methanamine;bis[(3-chlorophenyl)methyl]amine;N,N-Bis(3-chlorobenzyl)amine | | CAS: | 129041-31-2 | | MF: | C14H13Cl2N | | MW: | 266.17 | | EINECS: | 932-512-3 | | Product Categories: | | | Mol File: | 129041-31-2.mol |  |
| | N,N-Bis(3-chlorobenzyl)amine Chemical Properties |
| refractive index | 1.5880 to 1.5910 | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C14H13Cl2N/c15-13-5-1-3-11(7-13)9-17-10-12-4-2-6-14(16)8-12/h1-8,17H,9-10H2 | | InChIKey | DNKUGPCGNWRIJJ-UHFFFAOYSA-N | | SMILES | C1(CNCC2=CC=CC(Cl)=C2)=CC=CC(Cl)=C1 |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HS Code | 2921.49.5000 |
| Provider | Language |
|
ALFA
| English |
| | N,N-Bis(3-chlorobenzyl)amine Usage And Synthesis |
| | N,N-Bis(3-chlorobenzyl)amine Preparation Products And Raw materials |
|