|
|
| | 1H-Indole-6-carboxylic acid, 4-broMo-, Methyl ester Basic information |
| Product Name: | 1H-Indole-6-carboxylic acid, 4-broMo-, Methyl ester | | Synonyms: | 1H-Indole-6-carboxylic acid, 4-broMo-, Methyl ester;Methyl 4-broMo-1H-indole-6-carboxylate;Methyl 4-broMoindole-6-carboxylate;4-Bromoindole-6-Carbocylic acid methyl ester;Methyl 4-bromo-1h-indole-6-carboxylat;Ethyl6-bromo-1H-indole-4-carboxylate;4-Bromo indole-7-carboxylic acid methyl ester | | CAS: | 882679-96-1 | | MF: | C10H8BrNO2 | | MW: | 254.08 | | EINECS: | | | Product Categories: | | | Mol File: | 882679-96-1.mol |  |
| | 1H-Indole-6-carboxylic acid, 4-broMo-, Methyl ester Chemical Properties |
| Boiling point | 382.6±22.0 °C(Predicted) | | density | 1.629±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 14.87±0.30(Predicted) | | Appearance | off-white to light brown Solid | | InChI | InChI=1S/C10H8BrNO2/c1-14-10(13)6-4-8(11)7-2-3-12-9(7)5-6/h2-5,12H,1H3 | | InChIKey | BHADJPVQZXGIFH-UHFFFAOYSA-N | | SMILES | N1C2=C(C(Br)=CC(C(OC)=O)=C2)C=C1 |
| | 1H-Indole-6-carboxylic acid, 4-broMo-, Methyl ester Usage And Synthesis |
| | 1H-Indole-6-carboxylic acid, 4-broMo-, Methyl ester Preparation Products And Raw materials |
|