|
|
| | 4-Isobutyrylacetophenone Basic information |
| Product Name: | 4-Isobutyrylacetophenone | | Synonyms: | Ibuprofen Impurity 20 (4-Isobutyrylacetophenone);1-Propanone, 1-(4-acetylphenyl)-2-methyl-;Ibuprofen Impurity 46;Ibuprofen Impurity: 4-isobutyrylacetophenone;1-(4-Acetylphenyl)-2-methyl-1-propanone;Ibuprofen Unknown impurity, RRT 0.68 | | CAS: | 103931-20-0 | | MF: | C12H14O2 | | MW: | 190.24 | | EINECS: | | | Product Categories: | Aromatics;Impurities | | Mol File: | 103931-20-0.mol |  |
| | 4-Isobutyrylacetophenone Chemical Properties |
| Boiling point | 320.4±25.0 °C(Predicted) | | density | 1.023±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Colourless to Pale Yellow Semi-Solid | | Major Application | pharmaceutical | | InChI | 1S/C12H14O2/c1-8(2)12(14)11-6-4-10(5-7-11)9(3)13/h4-8H,1-3H3 | | InChIKey | OKDVJTURSCLUBA-UHFFFAOYSA-N | | SMILES | O=C(C(C)C)c1ccc(cc1)C(=O)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-Isobutyrylacetophenone Usage And Synthesis |
| Chemical Properties | Light Yellow Oil | | Uses | A potential impurity in Ibuprofen (I140000). |
| | 4-Isobutyrylacetophenone Preparation Products And Raw materials |
|