| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | 1,3-Bis(2-methoxyphenoxy)-2-propanol Basic information |
| Product Name: | 1,3-Bis(2-methoxyphenoxy)-2-propanol | | Synonyms: | 1,3-Bis(2-methoxyphenoxy)-2-propanol;1,3-Bis(o-methoxyphenoxy)-2-propanol;Guaifenesin EP impurity D;Guaicol Impurity D;NSC 142122;Guaifenesin impurity D (PhEur);Guaifenesin Impurity 4(Guaifenesin EP Impurity D);Dianisylglycerol | | CAS: | 16929-60-5 | | MF: | C17H20O5 | | MW: | 304.34 | | EINECS: | | | Product Categories: | | | Mol File: | 16929-60-5.mol |  |
| | 1,3-Bis(2-methoxyphenoxy)-2-propanol Chemical Properties |
| Melting point | 73-74.2℃ (ethyl ether ) | | Boiling point | 165-225 °C(Press: 9 Torr) | | density | 1.167±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | pka | 13.38±0.20(Predicted) | | form | Solid | | color | White to Off-White | | BRN | 2003232 | | Stability: | Hygroscopic | | Major Application | pharmaceutical | | InChI | 1S/C17H20O5/c1-19-14-7-3-5-9-16(14)21-11-13(18)12-22-17-10-6-4-8-15(17)20-2/h3-10,13,18H,11-12H2,1-2H3 | | InChIKey | SSNCGCIXFDVLFP-UHFFFAOYSA-N | | SMILES | OC(COC1=C(OC)C=CC=C1)COC2=CC=CC=C2OC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | RTECS | UA7374000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,3-Bis(2-methoxyphenoxy)-2-propanol Usage And Synthesis |
| Uses | 1,3-Bis(2-methoxyphenoxy)-2-propanol is an impurity of Atenolol (A790075), a cardioselective β-adrenergic blocker. 1,3-Bis(2-methoxyphenoxy)-2-propanol is also used in various preparations of organic
synthetic compounds. |
| | 1,3-Bis(2-methoxyphenoxy)-2-propanol Preparation Products And Raw materials |
|