|
|
| | Pinoresinol diMethyl ether Basic information |
| Product Name: | Pinoresinol diMethyl ether | | Synonyms: | O,O-Dimethylpinoresinol;1H,3H-Furo[3,4-c]furan, 1,4-bis(3,4-dimethoxyphenyl)tetrahydro-, (1S,3aR,4S,6aR)-;(+)-Eudesmin;(+)-Pinoresinol dimethyl ether;(1S,3aR,4S,6aR)-1,4-Bis(3,4-dimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan;(+)-Eudesmin-RM;Pinoresinol dimethyl ether, 10 mM in DMSO | | CAS: | 29106-36-3 | | MF: | C22H26O6 | | MW: | 386.44 | | EINECS: | 2017-001-1 | | Product Categories: | | | Mol File: | 29106-36-3.mol |  |
| | Pinoresinol diMethyl ether Chemical Properties |
| Melting point | 107-108℃ | | Boiling point | 517.3±50.0 °C(Predicted) | | density | 1.173±0.06 g/cm3(Predicted) | | storage temp. | Store at 4℃,protect from light | | solubility | Soluble in DMSO | | form | Solid | | color | White to off-white | | Major Application | food and beverages | | InChI | 1S/C22H26O6/c1-23-17-7-5-13(9-19(17)25-3)21-15-11-28-22(16(15)12-27-21)14-6-8-18(24-2)20(10-14)26-4/h5-10,15-16,21-22H,11-12H2,1-4H3/t15-,16-,21+,22+/m0/s1 | | InChIKey | PEUUVVGQIVMSAW-RZTYQLBFSA-N | | SMILES | O1[C@@H]([C@@H]3[C@@H]([C@H](OC3)c4cc(c(cc4)OC)OC)C1)c2cc(c(cc2)OC)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Pinoresinol diMethyl ether Usage And Synthesis |
| Uses | food and beverages | | Definition | ChEBI: (+)-Eudesmin is a lignan. |
| | Pinoresinol diMethyl ether Preparation Products And Raw materials |
|