|
|
| | 5-O-Methylgenistein Basic information |
| Product Name: | 5-O-Methylgenistein | | Synonyms: | 5-O-Methylgenistein;Isoprunetin;4H-1-Benzopyran-4-one, 7-hydroxy-3-(4-hydroxyphenyl)-5-methoxy-;Isoprunetin >=95% (LC/MS-ELSD) | | CAS: | 4569-98-6 | | MF: | C16H12O5 | | MW: | 284.26 | | EINECS: | | | Product Categories: | | | Mol File: | 4569-98-6.mol |  |
| | 5-O-Methylgenistein Chemical Properties |
| Melting point | 237-238 °C | | Boiling point | 567.9±50.0 °C(Predicted) | | density | 1.420±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 6.65±0.20(Predicted) | | form | solid | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C16H12O5/c1-20-13-6-11(18)7-14-15(13)16(19)12(8-21-14)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 | | InChIKey | YSINCDVRUMTOPK-UHFFFAOYSA-N | | SMILES | COc1cc(O)cc2OC=C(C(=O)c12)c3ccc(O)cc3 |
| Hazard Codes | T,N | | Risk Statements | 25-50 | | Safety Statements | 45-61 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1 |
| | 5-O-Methylgenistein Usage And Synthesis |
| Uses | metabolomics
vitamins, nutraceuticals, and natural products |
| | 5-O-Methylgenistein Preparation Products And Raw materials |
|