|
|
| | 10-isobutyryloxy-8,9-epoxythymol isobutyrate Basic information |
| Product Name: | 10-isobutyryloxy-8,9-epoxythymol isobutyrate | | Synonyms: | 10-isobutyryloxy-8,9-epoxythymol isobutyrate;Propanoic acid, 2-methyl-, 5-methyl-2-[2-[(2-methyl-1-oxopropoxy)methyl]-2-oxiranyl]phenyl ester;10-isobutyryloxy-8,9-epoxythymol isobutyrate >=95% (LC/MS-ELSD);10-\u200bIsobutyryloxy-\u200b8,\u200b9-\u200bepoxythymol isobutyrate;10-Isobutyryloxy-89-epoxythymyl isobutyrate | | CAS: | 22518-06-5 | | MF: | C18H24O5 | | MW: | 320.38 | | EINECS: | | | Product Categories: | | | Mol File: | 22518-06-5.mol |  |
| | 10-isobutyryloxy-8,9-epoxythymol isobutyrate Chemical Properties |
| Boiling point | 418.6±45.0 °C(Predicted) | | density | 1.123±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO | | form | solid | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C18H24O5/c1-11(2)16(19)21-9-18(10-22-18)14-7-6-13(5)8-15(14)23-17(20)12(3)4/h6-8,11-12H,9-10H2,1-5H3 | | InChIKey | OLARKEMZPWGFJU-UHFFFAOYSA-N | | SMILES | CC(C)C(=O)OCC1(CO1)c2ccc(C)cc2OC(=O)C(C)C |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 4
Eye Irrit. 2 |
| | 10-isobutyryloxy-8,9-epoxythymol isobutyrate Usage And Synthesis |
| Uses | metabolomics
vitamins, nutraceuticals, and natural products | | Definition | ChEBI: Bis(2-methylpropanoyloxy)-9,10-epoxy-p-mentha-1,3,5-triene is a benzoate ester and a member of phenols. |
| | 10-isobutyryloxy-8,9-epoxythymol isobutyrate Preparation Products And Raw materials |
|