- medicagenic acid
-
- $43.00
-
2026-07-15
- CAS:599-07-5
- Purity: 99.53%
- Supply Ability: 10g
- medicagenic acid
-
- $3.00
-
2020-01-19
- CAS:599-07-5
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1kg,5kg,50kg
|
| | medicagenic acid Basic information |
| Product Name: | medicagenic acid | | Synonyms: | Catsanogenin;Medicogenic acid;Castanogenin;NSC 382024;(4S)-2β,3β-Dihydroxyolean-12-ene-23,28-dioic acid;medicagenic acid USP/EP/BP;inhibit,Inhibitor,Bacterial,medicagenic acid;Olean-12-ene-23,28-dioic acid, 2,3-dihydroxy-, (2β,3β,4α)- | | CAS: | 599-07-5 | | MF: | C30H46O6 | | MW: | 502.69 | | EINECS: | | | Product Categories: | | | Mol File: | 599-07-5.mol |  |
| | medicagenic acid Chemical Properties |
| Melting point | 380-382℃ (dec.) | | Boiling point | 635.9±55.0 °C(Predicted) | | density | 1.23±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | Store at -20°C | | solubility | DMSO (Slightly), Methanol (Slightly), Pyridine | | pka | 4.30±0.70(Predicted) | | form | Solid | | color | White to Off-White | | Major Application | food and beverages | | InChIKey | IDGXIXSKISLYAC-WNTKNEGGSA-N | | SMILES | O[C@@H]1[C@@]([C@H]2[C@@]([C@@H]3[C@]([C@@]4(CC[C@@]5([C@@H](CC(CC5)(C)C)C4=CC3)C(=O)O)C)(CC2)C)(C[C@@H]1O)C)(C)C(=O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | medicagenic acid Usage And Synthesis |
| Chemical Properties | Soluble in methanol, ethanol, DMSO and other organic solvents, derived from the roots of legume alfalfa Medicago sativa L. | | Uses | Medicagenic acid is a versatile compound extracted from some plants, such as the branches of Eucommia ulmoides. It has antifungal properties towards candida albicans. | | Definition | ChEBI: Medicagenic acid is a triterpenoid. |
| | medicagenic acid Preparation Products And Raw materials |
|