|
|
| | 5-METHYL-1,2,4-OXADIAZOL-3-AMINE Basic information |
| Product Name: | 5-METHYL-1,2,4-OXADIAZOL-3-AMINE | | Synonyms: | 5-METHYL-1,2,4-OXADIAZOL-3-AMINE;5-methyl-[1,2,4]oxadiazol-3-ylamine;5-methyl-1,2,4-oxadiazol-3-amine(SALTDATA: FREE);3-aMino-5-Methyl-1,2,4-oxadiazole;1,2,4-Oxadiazol-3-amine, 5-methyl-;5-METHYL-1,2,4-OXADIAZOL-3(2H)-IMINE | | CAS: | 40483-47-4 | | MF: | C3H5N3O | | MW: | 99.09 | | EINECS: | | | Product Categories: | | | Mol File: | 40483-47-4.mol |  |
| | 5-METHYL-1,2,4-OXADIAZOL-3-AMINE Chemical Properties |
| Melting point | 117-119 °C | | Boiling point | 228.8±23.0 °C(Predicted) | | density | 1.283±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 1.54±0.24(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C3H5N3O/c1-2-5-3(4)6-7-2/h1H3,(H2,4,6) | | InChIKey | JEEUSAKCHSWJKO-UHFFFAOYSA-N | | SMILES | O1C(C)=NC(N)=N1 |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-METHYL-1,2,4-OXADIAZOL-3-AMINE Usage And Synthesis |
| | 5-METHYL-1,2,4-OXADIAZOL-3-AMINE Preparation Products And Raw materials |
|