| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
|
| | 7-Methylguanosine 5'-triphosphate sodium salt Basic information |
| | 7-Methylguanosine 5'-triphosphate sodium salt Chemical Properties |
| storage temp. | -20°C | | solubility | water: 50 mg/mL, clear, colorless to faint yellow or tan | | form | powder | | biological source | natural (inorganic) | | InChIKey | FSMRTZAMTMQMEF-OCMBMSOASA-M | | SMILES | [Na+].C[n+]1cn([C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)OP(O)([O-])=O)[C@@H](O)[C@H]2O)c3N=C(N)NC([O-])c13 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 7-Methylguanosine 5'-triphosphate sodium salt Usage And Synthesis |
| Uses | 7-Methylguanosine 5′-triphosphate (m7GTP) is use to study the structures and mechanisms of eukaryotic cellular mRNA caps in the context of mRNA involvement in protein synthesis. m7GTP may be used to create affinity media for capture and purification of molecules such as eukaryotic initiation factor eIF4E. | | General Description | 7-Methylguanosine 5′-triphosphate is a mRNA cap structural analog. | | Biochem/physiol Actions | 7-Methylguanosine 5′-triphosphate (m7GTP) inhibits in vitro protein synthesis by binding to translation initiation complexes. m7GTP is useful to study the structures and mechanisms of eukaryotic cellular mRNA caps in the context of mRNA involvement in protein synthesis. m7GTP has a high affinity for eukaryotic initiation factor eIF4E and may be used to create affinity media for their capture and purification. |
| | 7-Methylguanosine 5'-triphosphate sodium salt Preparation Products And Raw materials |
|