|
|
| | Triethylene glycol bis(2-ethylhexanoate) Basic information |
| Product Name: | Triethylene glycol bis(2-ethylhexanoate) | | Synonyms: | 1,2-bis-[2-(2-ethyl-hexanoyloxy)-ethoxy]-ethane;2-(2-(2-[(2-Ethylhexanoyl)oxy]ethoxy)ethoxy)ethyl 2-ethylhexanoate;2-ethyl-hexanoicacidiesterwithtriethyleneglycol;Ethane, 1,2-(2'-hydroxyethoxy)-, di-(2-ethylhexanoate)-;Flexol plasticizer 3go;flexol3go;flexolplasticizer3go;Hexanoic acid, 2-ethyl-, 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester | | CAS: | 94-28-0 | | MF: | C22H42O6 | | MW: | 402.57 | | EINECS: | 202-319-2 | | Product Categories: | | | Mol File: | 94-28-0.mol |  |
| | Triethylene glycol bis(2-ethylhexanoate) Chemical Properties |
| Melting point | −50 °C(lit.) | | Boiling point | 344 °C(lit.) | | density | 0.97 g/mL at 25 °C(lit.) | | vapor pressure | 0.001Pa at 25℃ | | refractive index | n20/D 1.445 | | Fp | >230 °F | | Water Solubility | Insoluble | | InChI | InChI=1S/C22H42O6/c1-5-9-11-19(7-3)21(23)27-17-15-25-13-14-26-16-18-28-22(24)20(8-4)12-10-6-2/h19-20H,5-18H2,1-4H3 | | InChIKey | FRQDZJMEHSJOPU-UHFFFAOYSA-N | | SMILES | C(OCCOC(=O)C(CC)CCCC)COCCOC(=O)C(CC)CCCC | | LogP | 6.1 at 25℃ | | NIST Chemistry Reference | Triethylene glycol, bis[2-ethylhexyl] etser(94-28-0) | | EPA Substance Registry System | Triethylene glycol bis(2-ethylhexanoate) (94-28-0) |
| Safety Statements | 24/25 | | WGK Germany | - | | RTECS | MO7725000 | | TSCA | TSCA listed | | HS Code | 29147000 |
| | Triethylene glycol bis(2-ethylhexanoate) Usage And Synthesis |
| Chemical Properties | CLEAR VERY SLIGHTLY YELLOW LIQUID | | Uses | Tri(ethylenglycol)bis-2-ethylhexanoate is a plasticizer; it is used method for improving dispersibility of PVB film viscosity modifier for automobile front windshield laminated glass. | | Definition | ChEBI: Triethylene glycol bis(2-ethylhexanoate) is a fatty acid ester. |
| | Triethylene glycol bis(2-ethylhexanoate) Preparation Products And Raw materials |
|