| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- L-Iditol
-
-
2026-09-17
- CAS:488-45-9
- Min. Order: 10G
- Purity: 98%min
- Supply Ability: 30kg/month
|
| | L-IDITOL Basic information |
| Product Name: | L-IDITOL | | Synonyms: | L-IDITOL;L-IDITOL 99%;Sorbierit;Sorbieritol;L-Iditol,98+%;L-Iditol,99%;D-Idit;(2R,3S,4S,5R)-hexane-1,2,3,4,5,6-hexol | | CAS: | 488-45-9 | | MF: | C6H14O6 | | MW: | 182.17 | | EINECS: | | | Product Categories: | 13C & 2H Sugars;Biochemistry;Idose;Sugar Alcohols;Sugars;Carbohydrates & Derivatives | | Mol File: | 488-45-9.mol |  |
| | L-IDITOL Chemical Properties |
| Melting point | 77 °C | | Boiling point | 235.55°C (rough estimate) | | density | 1.2393 (rough estimate) | | refractive index | -3 ° (C=1, H2O) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly, Sonicated), Methanol (Slightly), Water (Slightly, Sonicated) | | pka | 13.14±0.20(Predicted) | | form | Crystalline Powder | | color | White | | Water Solubility | water: 50mg/mL, clear, colorless | | InChI | 1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5+,6+/m0/s1 | | InChIKey | FBPFZTCFMRRESA-UNTFVMJOSA-N | | SMILES | OC[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29054900 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | L-IDITOL Usage And Synthesis |
| Chemical Properties | Off-White Crystalline Solid | | Uses | Occurs naturally along with D-Glucitol in plants, including in the berry of mountain ash (Sorbus aucuparia). Allitol, D-talitol and L-iditol are sugar alcohols that are rare in nature. | | Definition | ChEBI: L-iditol is the L-enantiomer of iditol. It has a role as a fungal metabolite and a human metabolite. It is an enantiomer of a D-iditol. | | IC 50 | Human Endogenous Metabolite |
| | L-IDITOL Preparation Products And Raw materials |
|