| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-bromonaphthalen-2-ol Basic information |
| Product Name: | 4-bromonaphthalen-2-ol | | Synonyms: | 4-bromonaphthalen-2-ol;1-Bromo-3-hydroxynaphthalene;4-Bromo-2-naphthalenol;2-Naphthalenol, 4-bromo-;4-bromonaphthalen-2-ol ISO 9001：2015 REACH | | CAS: | 5498-31-7 | | MF: | C10H7BrO | | MW: | 223.07 | | EINECS: | | | Product Categories: | | | Mol File: | 5498-31-7.mol |  |
| | 4-bromonaphthalen-2-ol Chemical Properties |
| Melting point | 122 °C | | Boiling point | 346.8±15.0 °C(Predicted) | | density | 1.614±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | pka | 8.76±0.40(Predicted) | | color | White to off-white | | InChI | InChI=1S/C10H7BrO/c11-10-6-8(12)5-7-3-1-2-4-9(7)10/h1-6,12H | | InChIKey | PQNQMYMGUXGWTG-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC=C2)=C(Br)C=C1O |
| | 4-bromonaphthalen-2-ol Usage And Synthesis |
| Uses | 4-Bromo-2-naphthalenol is used as a reactant in the preparation of pyrazoles as inhibitors of macrophage migration inhibitory factor. | | Synthesis | 4-Bromonaphthalen-2-ol is synthesized from naphthalen-1-amine in three steps. Step A: Naphthalen-1-amine reacts with Br2 in AcOH to give 2,4-dibromonaphthalen-1-amine. Step B: This product is diazotized with NaNO2 in AcOH/propionic acid at low temperature to yield 4-bromo-1-diazo-naphthalen-2-ol. Step C: This diazo compound is reduced with NaBH4 in EtOH. Work-up followed by purification via column chromatography and reversed-phase HPLC gives 4-bromonaphthalen-2-ol. |
| | 4-bromonaphthalen-2-ol Preparation Products And Raw materials |
|