|
|
| | ADINAZOLAM Basic information |
| Product Name: | ADINAZOLAM | | Synonyms: | ADINAZOLAM;8-Chloro-N,N-dimethyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-1-methanamine;U-41123;4H-[1,2,4]Triazolo[4,3-a][1,4]benzodiazepine-1-methanamine, 8-chloro-N,N-dimethyl-6-phenyl-;Adinazolamum;γ-Aminobutyric acid Receptor,sickness,antihistamine,GABA Receptor,inhibit,Adinazolam,U-41123,U 41123,Huntington,Gamma-aminobutyric acid Receptor,anti-motion,piperazine,U41123,Inhibitor;Adinazolam (CRM);Adinazolam solution | | CAS: | 37115-32-5 | | MF: | C19H18ClN5 | | MW: | 351.83 | | EINECS: | | | Product Categories: | | | Mol File: | 37115-32-5.mol |  |
| | ADINAZOLAM Chemical Properties |
| Melting point | 171-172.5° (US 4250094); mp 165-166° (DE 2201210) | | Boiling point | 527.0±60.0 °C(Predicted) | | density | 1.31±0.1 g/cm3(Predicted) | | storage temp. | -10 to -25°C | | form | Solid | | pka | pKa 6.2 (D2O/DClor D2O/NaOD ) (Uncertain);5.8±0.1(D2O/DClor D2O/NaOD ) (Uncertain) | | color | White to off-white | | InChI | 1S/C19H18ClN5/c1-24(2)12-18-23-22-17-11-21-19(13-6-4-3-5-7-13)15-10-14(20)8-9-16(15)25(17)18/h3-10H,11-12H2,1-2H3 | | InChIKey | GJSLOMWRLALDCT-UHFFFAOYSA-N | | SMILES | Clc1cc2c(cc1)[n]3c(nnc3CN(C)C)CN=C2c4ccccc4 |
| RIDADR | 3249 | | WGK Germany | WGK 2 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Flam. Liq. 2 |
| | ADINAZOLAM Usage And Synthesis |
| Uses | Antidepressant; sedative-hypnotic. | | Definition | ChEBI: A triazolo[4,3-a][1,4]benzodiazepine having a dimethylaminomethyl group at the 1-position, a phenyl group at the 6-position and a chloro substituent at the 8-position. | | in vivo | Adinazolam (6 mg/kg) increases shuttlebox avoidance acquisition in male Sprague-Dawley rats[2]. | Animal Model: | Male Sprague-Dawley rats weighing 409±30 g[2] | | Dosage: | 6 mg/kg | | Administration: | Administered i.p. in 2 mL/kg | | Result: | Increased avoidance acquisition in 195% as compared to control animals.
|
|
| | ADINAZOLAM Preparation Products And Raw materials |
|