|
|
| | 5-chloro-2-Thiopheneacetic acid Basic information |
| | 5-chloro-2-Thiopheneacetic acid Chemical Properties |
| Melting point | 65.5-66 °C | | Boiling point | 112-115 °C(Press: 0.5 Torr) | | density | 1.492±0.06 g/cm3(Predicted) | | storage temp. | -20°C, sealed storage, away from moisture | | pka | 4.10±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C6H5ClO2S/c7-5-2-1-4(10-5)3-6(8)9/h1-2H,3H2,(H,8,9) | | InChIKey | QAHATWMAZYFBSC-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)SC(Cl)=CC=1 |
| | 5-chloro-2-Thiopheneacetic acid Usage And Synthesis |
| | 5-chloro-2-Thiopheneacetic acid Preparation Products And Raw materials |
|