|
|
| | 4-bromothiophene-2-acetic acid Basic information |
| | 4-bromothiophene-2-acetic acid Chemical Properties |
| Melting point | 87-92℃ | | Boiling point | 331.2±27.0 °C(Predicted) | | density | 1.804±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | powder | | pka | 4.06±0.10(Predicted) | | color | Brown | | InChI | InChI=1S/C6H5BrO2S/c7-4-1-5(10-3-4)2-6(8)9/h1,3H,2H2,(H,8,9) | | InChIKey | RQLBAXZWESSFHI-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)SC=C(Br)C=1 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-bromothiophene-2-acetic acid Usage And Synthesis |
| | 4-bromothiophene-2-acetic acid Preparation Products And Raw materials |
|