|
|
| | 3-Fluoro-2-trifluoromethyl-isonicotinic acid Basic information |
| Product Name: | 3-Fluoro-2-trifluoromethyl-isonicotinic acid | | Synonyms: | 3-fluoro(trifluoromethyl)isonicotinic acid;3-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid;4-Pyridinecarboxylic acid, 3-fluoro-2-(trifluoromethyl)-;3-Fluoro-2-trifluoromethyl-isonicotinic acid | | CAS: | 886510-09-4 | | MF: | C7H3F4NO2 | | MW: | 209.1 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 3-Fluoro-2-trifluoromethyl-isonicotinic acid Chemical Properties |
| Melting point | 167-169°C | | Boiling point | 322.8±42.0 °C(Predicted) | | density | 1.573±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 2.01±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H3F4NO2/c8-4-3(6(13)14)1-2-12-5(4)7(9,10)11/h1-2H,(H,13,14) | | InChIKey | GOYPFNAZTPCXGS-UHFFFAOYSA-N | | SMILES | C1(C(F)(F)F)=NC=CC(C(O)=O)=C1F |
| Hazard Codes | Xn | | Risk Statements | 22 | | HS Code | 2933399990 |
| | 3-Fluoro-2-trifluoromethyl-isonicotinic acid Usage And Synthesis |
| Uses | 3-fluoro-2-trifluoromethyl-isonicotinic acid is mainly used in pharmaceutical synthesis and scientific research.
|
| | 3-Fluoro-2-trifluoromethyl-isonicotinic acid Preparation Products And Raw materials |
|