Benzenemethanol, 4-cyclohexyl-3-(trifluoromethyl)- manufacturers
|
| | Benzenemethanol, 4-cyclohexyl-3-(trifluoromethyl)- Basic information |
| Product Name: | Benzenemethanol, 4-cyclohexyl-3-(trifluoromethyl)- | | Synonyms: | Benzenemethanol, 4-cyclohexyl-3-(trifluoromethyl)-;(4-cyclohexyl-3-(trifluoromethyl)phenyl)methanol;SIPO-008;4-Cyclohexyl-3-(trifluoromethyl)benzyl Alcohol;4-Cyclohexyl-3-(trifluoromethyl)-benzenemethanol;[4-cyclohexyl-3-(trifluoromethyl)phenyl]methanol - [C88075] | | CAS: | 957205-23-1 | | MF: | C14H17F3O | | MW: | 258.28 | | EINECS: | | | Product Categories: | | | Mol File: | 957205-23-1.mol |  |
| | Benzenemethanol, 4-cyclohexyl-3-(trifluoromethyl)- Chemical Properties |
| Boiling point | 323.6±37.0 °C(Predicted) | | density | 1.184±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | 14.15±0.10(Predicted) | | Appearance | colorless liquid | | InChI | InChI=1S/C14H17F3O/c15-14(16,17)13-8-10(9-18)6-7-12(13)11-4-2-1-3-5-11/h6-8,11,18H,1-5,9H2 | | InChIKey | XIRMFYAEMKQCRT-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=C(C2CCCCC2)C(C(F)(F)F)=C1 |
| | Benzenemethanol, 4-cyclohexyl-3-(trifluoromethyl)- Usage And Synthesis |
| Uses | 4-Cyclohexyl-3-(trifluoromethyl)phenyl]methanol is an alcohol derivative and can be used as pharmaceutical intermediates. |
| | Benzenemethanol, 4-cyclohexyl-3-(trifluoromethyl)- Preparation Products And Raw materials |
|