| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
3,3,5-Trimethylcyclohexyl methacrylate manufacturers
|
| | 3,3,5-Trimethylcyclohexyl methacrylate Basic information |
| Product Name: | 3,3,5-Trimethylcyclohexyl methacrylate | | Synonyms: | 2-Propenoicacid,2-methyl-,3,3,5-trimethylcyclohexylester;LABOTEST-BB LT00159362;3,3,5-TRIMETHYLCYCLOHEXYL METHACRYLATE, 98%, MIXTURE OF ISOMERS;Isophorylmethacrylate;3,3,5-trimethylcyclohexyl methacrylate, mixture of isomers;methacrylic acid 3,3,5-trimethylcyclohexyl ester;3,3,5-Trimethylcyclohexyl 2-methyl-2-propenoate;3,3,5-Trimethylcyclohexyl methacrylate, mixture of isomers, 97%, stab. with 200ppm 4-methoxyphenol | | CAS: | 7779-31-9 | | MF: | C13H22O2 | | MW: | 210.31 | | EINECS: | 231-927-0 | | Product Categories: | Acrylic Monomers;C12 to C63Monomers;Carbonyl Compounds;Esters;Methacrylate | | Mol File: | 7779-31-9.mol |  |
| | 3,3,5-Trimethylcyclohexyl methacrylate Chemical Properties |
| Melting point | −15 °C(lit.) | | Boiling point | 79 °C1 mm Hg(lit.) | | density | 0.93 g/mL at 25 °C(lit.) | | vapor pressure | 7.3Pa at 25℃ | | refractive index | n20/D 1.456(lit.) | | Fp | 208 °F | | form | liquid | | Water Solubility | 5.3mg/L at 20℃ | | BRN | 3245062 | | InChI | 1S/C13H22O2/c1-9(2)12(14)15-11-6-10(3)7-13(4,5)8-11/h10-11H,1,6-8H2,2-5H3 | | InChIKey | DABQKEQFLJIRHU-UHFFFAOYSA-N | | SMILES | CC1CC(CC(C)(C)C1)OC(=O)C(C)=C | | LogP | 5.25 at 20℃ | | EPA Substance Registry System | 2-Propenoic acid, 2-methyl-, 3,3,5-trimethylcyclohexyl ester (7779-31-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1B STOT SE 3 |
| | 3,3,5-Trimethylcyclohexyl methacrylate Usage And Synthesis |
| Definition | ChEBI: 2-Propenoic acid, 2-methyl-, 3,3,5-trimethylcyclohexyl ester is an enoate ester. |
| | 3,3,5-Trimethylcyclohexyl methacrylate Preparation Products And Raw materials |
|