| Company Name: |
Shandong Jiecheng Pharmaceutical Co., Ltd Gold
|
| Tel: |
0531-83130525 18560095177 |
| Email: |
lily.chen@jiechengpharm.com |
| Products Intro: |
Product Name:Methyl 4-amino-5-(ethylthio)-2-methoxybenzoate
CAS:1119455-01-4
Purity:企业标准 Package:25KG;1KG；1tons
|
|
| | methyl 4-amino-5-(ethylthio)-2-methoxybenzoate Basic information |
| Product Name: | methyl 4-amino-5-(ethylthio)-2-methoxybenzoate | | Synonyms: | methyl 4-amino-5-(ethylthio)-2-methoxybenzoate;Amisulpride Impurity 4;Benzoic acid, 4-amino-5-(ethylthio)-2-methoxy-, methyl ester;Methyl 4-amino-5-(ethylthio)-2-methoxybenzoate (ASP-III);4-Amino-2-Methoxy-5-Ethylthiobenzoic Acid Methyl Ester
4--2--5-;4-Amino-2-Methoxy-5-Ethylthiobenzoic Acid Methyl Ester | | CAS: | 1119455-01-4 | | MF: | C11H15NO3S | | MW: | 241.31 | | EINECS: | | | Product Categories: | | | Mol File: | 1119455-01-4.mol |  |
| | methyl 4-amino-5-(ethylthio)-2-methoxybenzoate Chemical Properties |
| InChI | InChI=1S/C11H15NO3S/c1-4-16-10-5-7(11(13)15-3)9(14-2)6-8(10)12/h5-6H,4,12H2,1-3H3 | | InChIKey | NLBWZSGIHPCZBG-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(SCC)=C(N)C=C1OC |
| | methyl 4-amino-5-(ethylthio)-2-methoxybenzoate Usage And Synthesis |
| | methyl 4-amino-5-(ethylthio)-2-methoxybenzoate Preparation Products And Raw materials |
|