| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-(4-Chlorobenzenesulfonyl)butyric acid Basic information |
| Product Name: | 3-(4-Chlorobenzenesulfonyl)butyric acid | | Synonyms: | 3-(4-CHLOROBENZENESULPHONYL) BUTYRIC ACID;3-(4'-CHLOROBENZENESULFONYL)BUTYRIC ACID;3-[(4-chlorophenyl)sulfonyl]butanoic acid;3-(4-Chlorophenylsulfonyl)butyric acid;Butanoic acid, 3-[(4-chlorophenyl)sulfonyl]-;3-(4-Chlorobenzenesulfonyl)butyric acid | | CAS: | 175205-43-3 | | MF: | C10H11ClO4S | | MW: | 262.71 | | EINECS: | | | Product Categories: | | | Mol File: | 175205-43-3.mol |  |
| | 3-(4-Chlorobenzenesulfonyl)butyric acid Chemical Properties |
| Boiling point | 474.1±45.0 °C(Predicted) | | density | 1.399±0.06 g/cm3(Predicted) | | pka | 3.74±0.10(Predicted) | | form | solid | | InChI | 1S/C10H11ClO4S/c1-7(6-10(12)13)16(14,15)9-4-2-8(11)3-5-9/h2-5,7H,6H2,1H3,(H,12,13) | | InChIKey | NPUIQANQRDIHLU-UHFFFAOYSA-N | | SMILES | CC(CC(O)=O)S(=O)(=O)c1ccc(Cl)cc1 |
| Hazard Codes | Xi | | Risk Statements | 41 | | RIDADR | UN3261 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Eye Dam. 1 |
| Provider | Language |
|
ALFA
| English |
| | 3-(4-Chlorobenzenesulfonyl)butyric acid Usage And Synthesis |
| Uses | 3-(4''-Chlorobenzenesulfonyl)butyric Acid has been tested as a potential sweetener. |
| | 3-(4-Chlorobenzenesulfonyl)butyric acid Preparation Products And Raw materials |
|