|
|
| | 3-(Phenylsulfonyl)propionic acid Basic information |
| | 3-(Phenylsulfonyl)propionic acid Chemical Properties |
| Melting point | 128-130 °C (lit.) | | Boiling point | 458.9±37.0 °C(Predicted) | | density | 1.348±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | methanol: soluble25mg/mL, clear, colorless | | pka | 3.85±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H10O4S/c10-9(11)6-7-14(12,13)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11) | | InChIKey | WGTYYNCSWCKXAI-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCS(C1=CC=CC=C1)(=O)=O |
| WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 3-(Phenylsulfonyl)propionic acid Usage And Synthesis |
| Uses | 3-(Phenylsulfonyl)propionic acid may be used in chemical synthesis. |
| | 3-(Phenylsulfonyl)propionic acid Preparation Products And Raw materials |
|