|
|
| | 1-Adamantanecarbonyl chloride Basic information |
| | 1-Adamantanecarbonyl chloride Chemical Properties |
| Melting point | 49-51 °C(lit.) | | Boiling point | 135-136 °C10 mm Hg(lit.) | | density | 1.0490 (rough estimate) | | refractive index | 1.5364 (estimate) | | Fp | >230 °F | | storage temp. | Inert atmosphere,2-8°C | | solubility | soluble in Toluene | | form | Crystalline Solid | | color | White to almost white | | Water Solubility | may decompose | | Sensitive | Moisture Sensitive | | BRN | 389960 | | InChI | 1S/C11H15ClO/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2/t7-,8+,9-,11- | | InChIKey | MIBQYWIOHFTKHD-KJZNFTALSA-N | | SMILES | ClC(=O)C12C[C@H]3C[C@H](C[C@H](C3)C1)C2 | | CAS DataBase Reference | 2094-72-6(CAS DataBase Reference) | | NIST Chemistry Reference | 1-Adamantanecarboxlic acid chloride(2094-72-6) |
| Hazard Codes | C | | Risk Statements | 14-34-37 | | Safety Statements | 26-36/37/39-45-24/25 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29162090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 1-Adamantanecarbonyl chloride Usage And Synthesis |
| Chemical Properties | White to almost white crystalline solid | | Uses | 1-Adamantanecarbonyl chloride was used in the preparation of efficient amine-modified oligodeoxynucleotides for fabrication of DNA microarrays. | | General Description | 1-Adamantanecarbonyl chloride on reaction with triethylammonium isopropylphosphite forms mixed anhydride, an efficient capping reagent for the hydrogen-phosphonate DNA synthesis. It is a good substrate for Friedel–Crafts acylation of anisole in the presence of indium metal. |
| | 1-Adamantanecarbonyl chloride Preparation Products And Raw materials |
|