| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Tributylstannyltrimethylsilane Basic information |
| Product Name: | Tributylstannyltrimethylsilane | | Synonyms: | Trimethyl(tributylstannyl)silane 97%;Tributyl(trimethylsilyl)stannane;Trimethylsilyltri-n-butyltin 97%;(TRIMETHYLSILYL)TRIBUTYLSTANNANE;(TRIMETHYLSILYL)TRIBUTYLTIN;TRIMETHYLSILYLTRI-N-BUTYLTIN;(Trimethylsilyl)tri-n-butyltin, Tributyl(trimethylsilyl)stannane;(Tributylstannyl)trimethylsilane, (Trimethylsilyl)tributylstannane, (Trimethylsilyl)tributyltin, Tributyl(trimethylsilyl)stannane | | CAS: | 17955-46-3 | | MF: | C15H36SiSn | | MW: | 363.24 | | EINECS: | | | Product Categories: | Chemical Synthesis;Organometallic Reagents;Organotin;Organotins | | Mol File: | 17955-46-3.mol |  |
| | Tributylstannyltrimethylsilane Chemical Properties |
| Boiling point | 102-103 °C0.5 mm Hg(lit.) | | density | 1.04 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.488(lit.) | | Fp | >230 °F | | storage temp. | Store under Argon | | solubility | soluble in THF, ether, CH2Cl2, MeOH, hexane,
insoluble in water. | | form | liquid | | Specific Gravity | 1.040 | | Appearance | Colorless to light yellow Liquid | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | BRN | 4127163 | | InChI | 1S/3C4H9.C3H9Si.Sn/c3*1-3-4-2;1-4(2)3;/h3*1,3-4H2,2H3;1-3H3; | | InChIKey | MZUUBYSIDDKUKE-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)[Si](C)(C)C |
| Hazard Codes | T,N | | Risk Statements | 21-25-36/38-48/23/25-50/53 | | Safety Statements | 35-36/37/39-45-60-61 | | RIDADR | UN 2788 6.1/PG 3 | | WGK Germany | 3 | | F | 10-21 | | TSCA | No | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT RE 1 |
| | Tributylstannyltrimethylsilane Usage And Synthesis |
| Physical properties | colorless liquid. bp 88 °C (0.2 mmHg). | | Uses | Trimethylsilyltributylstannane is used for the vicinal bis-functionalization of alkynes, dienes,
allenes, activated olefins, 1,1-addition to isonitriles, for generation
of metal-free aryl and vinyl anions, for generation of benzynes and
quinonedimethanes; stereoselective bis-functionalization-cyclization of diynes, eneynes, bis-allenes, alleneynes, and allenealdehydes; silylation of allylic, propargylic derivatives, and aryl
bromides; formation of silyl and stannyl cuprates.It takes part in the reactions of Addition to Alkynes, Synthetic Applications of β-Trialkylsilylvinylstannanes, Addition to Isonitriles, Addition to Alkenes and 1,3-Dienes, Addition to Activated Double Bonds, Addition to Allenes, etc. | | Preparation | By treating freshly distilled tri-n-butylstannane with LDA followed by quenching with chlorotrimethylsilane. |
| | Tributylstannyltrimethylsilane Preparation Products And Raw materials |
|