- Perfluorohexadecane
-
-
2025-11-23
- CAS:355-49-7
- Min. Order: 2000KG
- Purity: 99.9%
- Supply Ability: 20tons
|
| | Perfluorohexadecane Basic information |
| Product Name: | Perfluorohexadecane | | Synonyms: | Hexadecane, tetratriacontafluoro-;perfluoro-N-hexadecane;tetratriacontafluorohexadecane;Perfluorinated paraffins;Perfluorohexadecane 97%;Perfluorohexadecane97%;Hexadecane,1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-tetratriacontafluoro-;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-tetratriacontafluorohexadecane | | CAS: | 355-49-7 | | MF: | C16F34 | | MW: | 838.12 | | EINECS: | 206-588-7 | | Product Categories: | | | Mol File: | 355-49-7.mol |  |
| | Perfluorohexadecane Chemical Properties |
| Melting point | 125-126°C | | Boiling point | 239-240°C | | density | 1.9000 (rough estimate) | | refractive index | 1.2830 (estimate) | | Fp | > 110 °C | | form | crystals | | color | White | | InChI | InChI=1S/C16F34/c17-1(18,3(21,22)5(25,26)7(29,30)9(33,34)11(37,38)13(41,42)15(45,46)47)2(19,20)4(23,24)6(27,28)8(31,32)10(35,36)12(39,40)14(43,44)16(48,49)50 | | InChIKey | AQPUCGPFMVEJGS-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | Perfluorohexadecane (355-49-7) |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2903493090 |
| | Perfluorohexadecane Usage And Synthesis |
| | Perfluorohexadecane Preparation Products And Raw materials |
|