| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-Ethyl-1-methylpyrrolidinium hexafluorophosphate Basic information |
| | 1-Ethyl-1-methylpyrrolidinium hexafluorophosphate Chemical Properties |
| Melting point | 261 °C | | form | solid | | InChI | 1S/C7H16N.F6P/c1-3-8(2)6-4-5-7-8;1-7(2,3,4,5)6/h3-7H2,1-2H3;/q+1;-1 | | InChIKey | WSYWUTMEDIHQRK-UHFFFAOYSA-N | | SMILES | F[P-](F)(F)(F)(F)F.CC[N+]1(C)CCCC1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 1-Ethyl-1-methylpyrrolidinium hexafluorophosphate Usage And Synthesis |
| | 1-Ethyl-1-methylpyrrolidinium hexafluorophosphate Preparation Products And Raw materials |
|