| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
1-Butyl-1-methylpyrrolidinium hexafluorophosphate manufacturers
|
| | 1-Butyl-1-methylpyrrolidinium hexafluorophosphate Basic information |
| | 1-Butyl-1-methylpyrrolidinium hexafluorophosphate Chemical Properties |
| Melting point | 70 °C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | BRN | 11148397 | | InChI | 1S/C9H20N.F6P/c1-3-4-7-10(2)8-5-6-9-10;1-7(2,3,4,5)6/h3-9H2,1-2H3;/q+1;-1 | | InChIKey | HCGXEKKFZYYPFF-UHFFFAOYSA-N | | SMILES | F[P-](F)(F)(F)(F)F.CCCC[N+]1(C)CCCC1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933.99.8290 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | 1-Butyl-1-methylpyrrolidinium hexafluorophosphate Usage And Synthesis |
| | 1-Butyl-1-methylpyrrolidinium hexafluorophosphate Preparation Products And Raw materials |
|