- Acetone diphenylamine
-
- $1.10
-
2026-08-20
- CAS:68412-48-6
- Min. Order: 1g
- Purity: 99.0% Min
- Supply Ability: 100 Tons
- Acetone diphenylamine
-
- $1.00
-
2020-01-13
- CAS:68412-48-6
- Min. Order: 1KG
- Purity: 98%HPLC
- Supply Ability: 10tons
|
| | Acetone diphenylamine Basic information |
| Product Name: | Acetone diphenylamine | | Synonyms: | 2-Propanone,reactionproductswithdiphenylamine;acetonediphenylaminecondensationproducts;AGERITE SUPERLITE;AGERITE SUPERLITE SOLID;AGERITE SUPERFLEX;AGERITE SUPERFLEX SOLID G;AGERITE GELTROL;AGERITE HIPAR T | | CAS: | 68412-48-6 | | MF: | C15H17NO | | MW: | 227.31 | | EINECS: | 270-192-0 | | Product Categories: | UVCBs-organic | | Mol File: | 68412-48-6.mol |  |
| | Acetone diphenylamine Chemical Properties |
| Boiling point | 400℃[at 101 325 Pa] | | density | 1.129[at 20℃] | | vapor pressure | 0.042Pa at 20℃ | | Water Solubility | 5.75mg/L at 20℃ | | InChI | InChI=1S/C12H11N.C3H6O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2)4/h1-10,13H;1-2H3 | | InChIKey | GZNRISJLOXVOSH-UHFFFAOYSA-N | | SMILES | C(=O)(C)C.N(C1C=CC=CC=1)C1C=CC=CC=1 | | LogP | 6.5 at 25℃ | | EPA Substance Registry System | 2-Propanone, reaction products with diphenylamine (68412-48-6) |
| | Acetone diphenylamine Usage And Synthesis |
| Flammability and Explosibility | Not classified |
| | Acetone diphenylamine Preparation Products And Raw materials |
|