| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
1,1-Bis(3-cyclohexyl-4-hydroxyphenyl)cyclohexane manufacturers
|
| | 1,1-Bis(3-cyclohexyl-4-hydroxyphenyl)cyclohexane Basic information |
| Product Name: | 1,1-Bis(3-cyclohexyl-4-hydroxyphenyl)cyclohexane | | Synonyms: | 4,4'-(Cyclohexane-1,1-diyl)bis(2-cyclohexylphenol);Phenol,4,4'-cyclohexylidenebis[2-cyclohexyl-;1,1-Bis(3-cyclohexyl-4-hydroxyphenyl)cyclohexane >;4,4'-Cyclohexane-1,1-diylbis(2-cyclohexylphenol);4,4'-CYCLOHEXYLIDENEBIS(2-CYCLOHEXYLPHENOL);1,1-Bis(3-cyclohexyl-4-hydroxyphenyl)cyclohexane | | CAS: | 4221-68-5 | | MF: | C30H40O2 | | MW: | 432.64 | | EINECS: | | | Product Categories: | Color Former & Related Compounds;Developer;Fluorenes, etc. (reagent for high-performance polymer research);Functional Materials;Reagent for High-Performance Polymer Research | | Mol File: | 4221-68-5.mol |  |
| | 1,1-Bis(3-cyclohexyl-4-hydroxyphenyl)cyclohexane Chemical Properties |
| Melting point | 166 °C | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C30H40O2/c31-28-16-14-24(20-26(28)22-10-4-1-5-11-22)30(18-8-3-9-19-30)25-15-17-29(32)27(21-25)23-12-6-2-7-13-23/h14-17,20-23,31-32H,1-13,18-19H2 | | InChIKey | DNCLEPRFPJLBTQ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(O)C(C3CCCCC3)=C2)(C2=CC=C(O)C(C3CCCCC3)=C2)CCCCC1 |
| | 1,1-Bis(3-cyclohexyl-4-hydroxyphenyl)cyclohexane Usage And Synthesis |
| | 1,1-Bis(3-cyclohexyl-4-hydroxyphenyl)cyclohexane Preparation Products And Raw materials |
|