| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,2-Bis(4-hydroxy-3-isopropylphenyl)propane Basic information |
| | 2,2-Bis(4-hydroxy-3-isopropylphenyl)propane Chemical Properties |
| Melting point | 98 °C | | Boiling point | 195 °C / 0.6mmHg | | density | 1.042±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 10.38±0.10(Predicted) | | form | Solid | | color | White to Pale Yellow | | InChI | InChI=1S/C21H28O2/c1-13(2)17-11-15(7-9-19(17)22)21(5,6)16-8-10-20(23)18(12-16)14(3)4/h7-14,22-23H,1-6H3 | | InChIKey | IJWIRZQYWANBMP-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(O)C(C(C)C)=C1)(C1=CC=C(O)C(C(C)C)=C1)(C)C |
| | 2,2-Bis(4-hydroxy-3-isopropylphenyl)propane Usage And Synthesis |
| Uses | Bisphenol G is used as an analyte in analytical studies of rapid multiresidue determination of bisphenol analogs in soil with online derivatization. Bisphenol G is a derivative of Bisphenol A (B519495). |
| | 2,2-Bis(4-hydroxy-3-isopropylphenyl)propane Preparation Products And Raw materials |
|