- BCECF
-
- $54.00
-
2026-08-03
- CAS:85138-49-4
- Purity:
- Supply Ability: 10g
|
| | 2`,7`-Bis(2-carboxyethyl)-5(6)-carboxyfluorescein Basic information |
| Product Name: | 2`,7`-Bis(2-carboxyethyl)-5(6)-carboxyfluorescein | | Synonyms: | 2',7'-bis(Carboxyethyl)-5(6)-Carboxyfluorescein(BCECF);2',7'-bis(Carboxyethyl)-5(6)-Carboxyfluorescein (B;2',7'-Bis(carboxyethyl)-4or5-carboxyfluorescein;2'',7''-Bis-(2-carboxyethyl)-4(5)-carboxyfluorescein;2'',7''-BIS(2-CARBOXYETHYL)-5(6)- CARBOXYFLUORESCEIN (BCECF);2'7'-BIS-(2-CARBOXYETHYL)-5-(AND-6) FLUORESCEIN;2',7'-BIS-(CARBOXYETHYL)-5(6')-CARBOXYFLUORESCEIN;2',7'-BIS(CARBOXYETHYL)-5(6)-CARBOXYFLUORESCEIN | | CAS: | 85138-49-4 | | MF: | C27H20O11 | | MW: | 520.44 | | EINECS: | | | Product Categories: | | | Mol File: | 85138-49-4.mol |  |
| | 2`,7`-Bis(2-carboxyethyl)-5(6)-carboxyfluorescein Chemical Properties |
| storage temp. | -20°C | | solubility | DMF: 5 mg/ml; DMSO: 15 mg/ml; DMSO:PBS (pH 7.2) (1:2): 0.25 mg/ml; Ethanol: 5 mg/ml | | form | A crystalline solid | | color | Yellow to orange | | Appearance | Solid Powder | | BRN | 8375770 | | InChIKey | DKROGDOAOXDINY-UHFFFAOYSA-N | | SMILES | OC(=O)CCc1cc2c(OC3=CC(=O)C(CCC(O)=O)=CC3=C2c4cc(ccc4C(O)=O)C(O)=O)cc1O |
| | 2`,7`-Bis(2-carboxyethyl)-5(6)-carboxyfluorescein Usage And Synthesis |
| Description | BCECF is a fluorescent cytoplasmic pH-sensitive indicator. pH is measured by the ratio of emission intensity. | | Uses | 2`,7`-Bis(2-carboxyethyl)-5(6)-carboxyfluorescein is useful for pH measurements in intercellular spaces of epithelial cell monolayers, interstitial spaces of normal and neoplastic tissue and isolated cell fractions. Reliable measure of in vitro cellular cytotoxicity. | | Uses | 2′,7′-Bis(2-carboxyethyl)-5(6)-carboxyfluorescein has been used in a fluorescence-based screening assay, to determine the pH. | | Biochem/physiol Actions | Fluorescent indicator for measurement of cytoplasmic pH in lymphocytes. | | Excitation / Emission Maximum | 440-490 nm/535 nm |
| | 2`,7`-Bis(2-carboxyethyl)-5(6)-carboxyfluorescein Preparation Products And Raw materials |
|