| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Methyl-1,1-diphenylurea Basic information |
| | 3-Methyl-1,1-diphenylurea Chemical Properties |
| Melting point | 172-174 °C (lit.) | | Boiling point | 367.89°C (rough estimate) | | density | 1.0852 (rough estimate) | | vapor pressure | 0Pa at 20℃ | | refractive index | 1.6419 (estimate) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 14.83±0.46(Predicted) | | form | Solid | | color | Off-White to Light Blue | | Water Solubility | 234.8mg/L at 20℃ | | InChI | 1S/C14H14N2O/c1-15-14(17)16(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3,(H,15,17) | | InChIKey | IMFYAZJNDOZIFV-UHFFFAOYSA-N | | SMILES | CNC(=O)N(c1ccccc1)c2ccccc2 | | LogP | 1.69 at 25℃ | | CAS DataBase Reference | 13114-72-2(CAS DataBase Reference) | | EPA Substance Registry System | N'-Methyl-N,N-diphenylurea (13114-72-2) |
| Safety Statements | 36/37 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2924210000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
STOT RE 2 Oral |
| | 3-Methyl-1,1-diphenylurea Usage And Synthesis |
| Uses | N''-Methyl-N,N-diphenylurea is used in the stabilization of thermal propellants. Temozolomide USP Related Compound B. | | Definition | ChEBI: N'-methyl-N,N-diphenylurea is a member of benzenes. | | Synthesis Reference(s) | Tetrahedron Letters, 29, p. 651, 1988 DOI: 10.1016/S0040-4039(00)80173-2 | | General Description | Needles or grayish-white powder. | | Air & Water Reactions | Insoluble in water. | | Reactivity Profile | 3-METHYL-1,1-DIPHENYLUREA is an amide. Amides/imides react with azo and diazo compounds to generate toxic gases. Flammable gases are formed by the reaction of organic amides/imides with strong reducing agents. Amides are very weak bases (weaker than water). Imides are less basic yet and in fact react with strong bases to form salts. That is, they can react as acids. Mixing amides with dehydrating agents such as P2O5 or SOCl2 generates the corresponding nitrile. The combustion of these compounds generates mixed oxides of nitrogen (NOx). | | Fire Hazard | Flash point data for 3-METHYL-1,1-DIPHENYLUREA are not available. 3-METHYL-1,1-DIPHENYLUREA is probably combustible. | | Flammability and Explosibility | Not classified |
| | 3-Methyl-1,1-diphenylurea Preparation Products And Raw materials |
|