- Urea phosphate
-
- $1550.00
-
2026-07-01
- CAS:4861-19-2
- Min. Order: 10Tons
- Purity: 99%
- Supply Ability: 100
- urea phosphate
-
- $10.70
-
2026-05-28
- CAS:4861-19-2
- Min. Order: 10kg
- Purity: 99%
- Supply Ability: 10000kg
- UREA PHOSPHATE
-
-
2026-03-22
- CAS:4861-19-2
- Min. Order: 25KG
- Purity: 44
- Supply Ability: 200 tons
|
| | Urea phosphate Basic information |
| Product Name: | Urea phosphate | | Synonyms: | Urea phosphate salt >=98.0% (N);Phosphoricacid,compd.withurea;Urea,compd.withphosphoricacid;Urea PhosphateUP;Urea,phosphate(1:1);Ureaphosphate(1:1);Urea-phosphoricacid;UREA PHOSPHATE | | CAS: | 4861-19-2 | | MF: | CH7N2O5P | | MW: | 158.05 | | EINECS: | 225-464-3 | | Product Categories: | | | Mol File: | 4861-19-2.mol |  |
| | Urea phosphate Chemical Properties |
| Melting point | 116-118 °C (dec.)(lit.) | | density | 1.77[at 20℃] | | vapor pressure | 0.001Pa at 19.85℃ | | storage temp. | 2-8°C, sealed storage, away from moisture | | solubility | H2O: 50 mg/mL, clear | | form | Solid | | color | Colorless crystals | | Water Solubility | 50 mg/mL | | InChI | InChI=1S/CH4N2O.H3O4P/c2-1(3)4;1-5(2,3)4/h(H4,2,3,4);(H3,1,2,3,4) | | InChIKey | DZHMRSPXDUUJER-UHFFFAOYSA-N | | SMILES | P(O)(O)(=O)O.C(=O)(N)N | | LogP | -1.73 at 20℃ | | CAS DataBase Reference | 4861-19-2(CAS DataBase Reference) | | EPA Substance Registry System | Urea phosphate (1:1) (4861-19-2) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 22-24/25-45-36/37/39-26 | | RIDADR | UN 3261 8 / PGII | | WGK Germany | 1 | | TSCA | TSCA listed | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Urea phosphate Usage And Synthesis |
| Chemical Properties | Urea phosphate(CO(NH₂)₂·H₃PO₄) is a white, rhombic crystalline compound that is readily soluble in water and alcohol. Its aqueous solution is acidic, with a pH of 1.6–2.4, while a 1% aqueous solution has a pH of 1.89. Due to its acidic nature, urea phosphate is frequently used for the reclamation of saline-alkaline soils. When applied to soil, it can moderately lower the pH of the soil and specific microsites within it, thereby altering the soil acid–base balance, improving its physicochemical properties and structure, and promoting crop growth. | | Uses | Catalyst for acid-setting resins, flame-proofing compositions, cleaning compounds, acidulant. | | Uses | Urea Phosphate Salt is used in the production technology of fertilizers for fertigation of orchards and berry fields. | | Preparation | Urea phosphate is produced by the reaction of urea and phosphoric acid. The chemical equation is: H₃PO₄ + CO(NH₂)₂ → CO(NH₂)₂·H₃PO₄ | | Hazard | Evolves toxic fumes when heated. | | Flammability and Explosibility | Non flammable |
| | Urea phosphate Preparation Products And Raw materials |
|