|
|
| | FUSICOCCIN Basic information |
| Product Name: | FUSICOCCIN | | Synonyms: | FUSICOCCIN;fusicoccin from fusicoccum amygdali;3-[2-(Acetyloxy)-1-methylethyl]-1,2,4,5,6,6a,7,8,9,10a-decahydro-1,5-dihydroxy-9-(methoxymethyl)-6,10a-dimethylcyclopenta[a,d]-dicylo coten-4-yl-6;.alpha.-D-Glucopyranoside, 3-[2-(acetyloxy)-1-methylethyl]-1,2,4,5,6,6A,7,8,9,10A-decahydro-1,5-dihydroxy-9-(methoxymethyl)-6,10A-dimethyldicyclopenta[A,D]cycloocten-4-yl 6-o-(1,1-dimethyl-2-propenyl)-, 3-acetate, [1S-[1.alpha.,3(R*),4.alpha.,5.beta.,6.beta.,6A.alpha.,9.beta.,10A.beta.]]-;Fucicoccin;Fusicoccin a;Nsc113500;Fusicoccin-A
(Fusicoccin | | CAS: | 20108-30-9 | | MF: | C36H56O12 | | MW: | 680.82 | | EINECS: | | | Product Categories: | Carbohydrates;Carbohydrates A to;Carbohydrates D-FBiochemicals and Reagents;Monosaccharide | | Mol File: | 20108-30-9.mol |  |
| | FUSICOCCIN Chemical Properties |
| Melting point | 155-156 °C | | Boiling point | 760.188±60.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.242±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | −20°C | | solubility | DMSO: Soluble | | form | White solid. | | pka | 12.588±0.70(predicted) | | color | White to off-white | | biological source | plant (Fusicoccum amygdali) | | InChIKey | KXTYBXCEQOANSX-QFEZKATASA-N | | SMILES | COCC1CCC2C(C)C(O)C(OC3OC(COC(C)(C)C=C)C(O)C(OC(C)=O)C3O)C4=C(CC(O)C4(C)C=C12)C(C)COC(C)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | FUSICOCCIN Usage And Synthesis |
| Uses | Fusicoccin is a 14-3-3-dependent activator of H+-ATPase. | | Definition | ChEBI: Fusicoccin is an acetate ester. It has a role as a toxin. |
| | FUSICOCCIN Preparation Products And Raw materials |
|