|
|
| | 3-(3-METHYLPHENYL)BENZALDEHYDE Basic information |
| Product Name: | 3-(3-METHYLPHENYL)BENZALDEHYDE | | Synonyms: | 3'-METHYLBIPHENYL-3-CARBALDEHYDE;3'-METHYL-BIPHENYL-3-CARBOXALDEHYDE;3'-METHYL[1,1'-BIPHENYL]-3-CARBALDEHYDE;3'-METHYL [1,1'-BIPHENYL]-3-CARBOXALDEHYDE;AKOS BAR-0067;3-(3-METHYLPHENYL)BENZALDEHYDE;3-(3-Tolyl)benzaldehyde;[1,1'-Biphenyl]-3-carboxaldehyde, 3'-methyl- | | CAS: | 216443-78-6 | | MF: | C14H12O | | MW: | 196.24 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 216443-78-6.mol |  |
| | 3-(3-METHYLPHENYL)BENZALDEHYDE Chemical Properties |
| Boiling point | 337.3±21.0 °C(Predicted) | | density | 1.074±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | InChI | 1S/C14H12O/c1-11-4-2-6-13(8-11)14-7-3-5-12(9-14)10-15/h2-10H,1H3 | | InChIKey | KAGSXBNQBKIILK-UHFFFAOYSA-N | | SMILES | Cc1cccc(c1)-c2cccc(C=O)c2 | | CAS DataBase Reference | 216443-78-6(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-(3-METHYLPHENYL)BENZALDEHYDE Usage And Synthesis |
| Uses | 3''-Methyl-[1,1''-biphenyl]-3-carbaldehyde acts as a reagent in the organic synthesis of benzoxazoles derivatives and substituted nitrobenzaldehydes. |
| | 3-(3-METHYLPHENYL)BENZALDEHYDE Preparation Products And Raw materials |
|