|
|
| | 2,2-Dimethyl-1-propylamine sulphate Basic information |
| Product Name: | 2,2-Dimethyl-1-propylamine sulphate | | Synonyms: | 2,2-DIMETHYL-1-PROPYLAMINESULFATE;Dimethylpropylaminesulfate;2,2-Dimethyl-1-propylamine sulphate 97%;2,2-Dimethyl-1-propylaminesulphate97%;2,2-Dimethyl-1-propylamine sulphate | | CAS: | 68306-49-0 | | MF: | C5H15NO4S | | MW: | 185.24 | | EINECS: | | | Product Categories: | | | Mol File: | 68306-49-0.mol |  |
| | 2,2-Dimethyl-1-propylamine sulphate Chemical Properties |
| Melting point | >300°C | | InChI | InChI=1S/C5H13N.H2O4S/c1-5(2,3)4-6;1-5(2,3)4/h4,6H2,1-3H3;(H2,1,2,3,4) | | InChIKey | OORMCFJNCGHJGR-UHFFFAOYSA-N | | SMILES | S(=O)(=O)(O)O.C(C)(C)(C)CN | | CAS DataBase Reference | 68306-49-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Hazard Note | Irritant |
| | 2,2-Dimethyl-1-propylamine sulphate Usage And Synthesis |
| | 2,2-Dimethyl-1-propylamine sulphate Preparation Products And Raw materials |
|