| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | Nonamethyltrisilazane Basic information |
| Product Name: | Nonamethyltrisilazane | | Synonyms: | ((CH3)3Si)3N;1,1,1-trimethyl-n,n-bis(trimethylsilyl)-silanamin;1,1,1-trimethyl-N,N-bis(trimethylsilyl)-Silanamine;Amine, tris(trimethylsilyl)-;N,N,N-Tris(trimethylsilyl)amine;Silanamine,1,1,1-trimethyl-N,N-bis(trimethylsilyl)-;NITRILOTRIS(TRIMETHYLSILANE);NMTS~Tris(trimethylsilyl)amine | | CAS: | 1586-73-8 | | MF: | C9H27NSi3 | | MW: | 233.57 | | EINECS: | 216-445-0 | | Product Categories: | organosilicon compound | | Mol File: | 1586-73-8.mol |  |
| | Nonamethyltrisilazane Chemical Properties |
| Melting point | 67-69 °C (lit.) | | Boiling point | 72 °C/10 mmHg (lit.) | | density | 0.863 | | refractive index | 1.4550 | | Fp | 67°C | | storage temp. | 2-8°C, sealed storage, away from moisture and light | | pka | pK1:4.70(+1) (25°C) | | form | solid | | Specific Gravity | 0.8635 | | color | white to colorless waxy | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | Sensitive | Moisture Sensitive | | BRN | 1851880 | | InChI | InChI=1S/C9H27NSi3/c1-11(2,3)10(12(4,5)6)13(7,8)9/h1-9H3 | | InChIKey | PEGHITPVRNZWSI-UHFFFAOYSA-N | | SMILES | [Si](C)(C)(C)N([Si](C)(C)C)[Si](C)(C)C | | CAS DataBase Reference | 1586-73-8(CAS DataBase Reference) | | EPA Substance Registry System | Silanamine, 1,1,1-trimethyl-N,N-bis(trimethylsilyl)- (1586-73-8) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3259 8/PG 3 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Nonamethyltrisilazane Usage And Synthesis |
| Chemical Properties | Colorless crystals |
| | Nonamethyltrisilazane Preparation Products And Raw materials |
|