| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Ethyl 5-methoxyindole-2-carboxylate Basic information |
| | Ethyl 5-methoxyindole-2-carboxylate Chemical Properties |
| Melting point | 154-157°C | | Boiling point | 380.2±22.0 °C(Predicted) | | density | 1.216±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | crystalline | | pka | 14.72±0.30(Predicted) | | color | yellow to orange | | Water Solubility | Insoluble in water. | | BRN | 178104 | | InChI | InChI=1S/C12H13NO3/c1-3-16-12(14)11-7-8-6-9(15-2)4-5-10(8)13-11/h4-7,13H,3H2,1-2H3 | | InChIKey | NPIUAXNFAUGNHP-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(OC)C=C2)C=C1C(OCC)=O | | CAS DataBase Reference | 4792-58-9(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | NL6010000 | | HazardClass | IRRITANT | | Storage Class | 13 - Non Combustible Solids |
| | Ethyl 5-methoxyindole-2-carboxylate Usage And Synthesis |
| Uses | It is reactant for preparation of ligands with binding specificity towards the GABA receptor, sodium-dependent glucose co-transporter 2 (SGLT2) inhibitors for the management of hyperglycemia in diabetes, anticancer agents,integrase strand-transfer inhibitors (INSTIs),inhibitor of Proliferation of Colon Cancer Cells ,isomeridianin G as GSK-3 inhibitors, HIV-1 integrase inhibitors and inhibitors of mitogen activated protein kinase-activated protein kinase 2 (MK-2). |
| | Ethyl 5-methoxyindole-2-carboxylate Preparation Products And Raw materials |
|