| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
|
| | 4,4',4''-Trihydroxytriphenylmethane Basic information |
| Product Name: | 4,4',4''-Trihydroxytriphenylmethane | | Synonyms: | 4fdp;trihydroxytriphenylmethane;TRIS(4-HYDROXYPHENYL)METHANE;4-[bis(4-hydroxyphenyl)methyl]phenol;4,4',4'-METHANETRIYLTRIPHENOL;AV Lite BIP-PHBZ;BIP-PHBZ;BisP-PHBA | | CAS: | 603-44-1 | | MF: | C19H16O3 | | MW: | 292.33 | | EINECS: | 210-040-2 | | Product Categories: | | | Mol File: | 603-44-1.mol |  |
| | 4,4',4''-Trihydroxytriphenylmethane Chemical Properties |
| Melting point | 247 °C | | Boiling point | 503.8±45.0 °C(Predicted) | | density | 1.282±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | pka | 9.83±0.10(Predicted) | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | InChI | InChI=1S/C19H16O3/c20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15/h1-12,19-22H | | InChIKey | WFCQTAXSWSWIHS-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(O)C=C1)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1 | | CAS DataBase Reference | 603-44-1(CAS DataBase Reference) |
| | 4,4',4''-Trihydroxytriphenylmethane Usage And Synthesis |
| Uses | 4,4‘,4’'-Trihydroxytriphenylmethane can be used to prepare a low-melting polycarbonitrile phthalonitrile monomer (MDTP) containing an alkyl centre, which can be cured to give MDTP polymers. MDTP is synthesised by nucleophilic substitution of 4,4′,4′′-trihydroxytriphenylmethane and 4-nitrophthalonitrile[1]. | | References | [1] SHENGNAN BAI. Synthesis and Properties of A Low Melting Point Phthalonitrile Resin Containing High Density Nitrile Groups[J]. ChemistrySelect, 2020. DOI:10.1002/slct.201903930. |
| | 4,4',4''-Trihydroxytriphenylmethane Preparation Products And Raw materials |
|