2,4-DIAMINO-6-HYDROXY-5-NITROSOPYRIMIDINE manufacturers
|
| | 2,4-DIAMINO-6-HYDROXY-5-NITROSOPYRIMIDINE Basic information |
| Product Name: | 2,4-DIAMINO-6-HYDROXY-5-NITROSOPYRIMIDINE | | Synonyms: | 2,6-diamino-5-nitroso-4-pyrimidino;2,6-diamino-5-nitroso-4-pyrimido;4-Hydroxy-5-nitroso-2,6-diaminopyrimidine;2,6-diaMino-5-nitrosopyriMidin-4-ol;2,4-Diamino-5-nitrosopyrimidin-6-ol;2,6-Diamino-5-nitroso-4(1H)-pyrimidinone;AKOS MSC-0110;2,6-DIAMINO-4-HYDROXY-5-NITROSOPYRIMIDINE | | CAS: | 2387-48-6 | | MF: | C4H5N5O2 | | MW: | 155.11 | | EINECS: | 219-214-2 | | Product Categories: | Pyridines, Pyrimidines, Purines and Pteredines;Nucleotides and Nucleosides;Bases & Related Reagents;Nucleotides;Sulfur & Selenium Compounds | | Mol File: | 2387-48-6.mol |  |
| | 2,4-DIAMINO-6-HYDROXY-5-NITROSOPYRIMIDINE Chemical Properties |
| Melting point | >360°C | | Boiling point | 271.6±50.0 °C(Predicted) | | density | 2.19±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | DMSO (Very Slightly, Heated, Sonicated), Water (Very Slightly, Heated, Sonicated) | | form | Solid | | pka | 8.33±0.50(Predicted) | | color | Pale Red to Light Red | | InChI | InChI=1S/C4H5N5O2/c5-2-1(9-11)3(10)8-4(6)7-2/h(H5,5,6,7,8,10) | | InChIKey | HVMRLFSFHWCUCG-UHFFFAOYSA-N | | SMILES | C1(N)=NC(N)=C(N=O)C(=O)N1 | | CAS DataBase Reference | 2387-48-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 20/21/22-40 | | Safety Statements | 26-36/37/39 | | RTECS | UW6125000 | | Hazard Note | Irritant | | HS Code | 2933599590 | | Toxicity | mouse,LDLo,intraperitoneal,500mg/kg (500mg/kg),"Summary Tables of Biological Tests," National Research Council Chemical-Biological Coordination Center. Vol. 4, Pg. 322, 1952. |
| Provider | Language |
|
ALFA
| English |
| | 2,4-DIAMINO-6-HYDROXY-5-NITROSOPYRIMIDINE Usage And Synthesis |
| Chemical Properties | Red Rose Solid | | Uses | 2,6-Diamino-4-hydroxy-5-nitrosopyrimidine could be a potential antibiotic against Clostridioides difficile. |
| | 2,4-DIAMINO-6-HYDROXY-5-NITROSOPYRIMIDINE Preparation Products And Raw materials |
|