| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Rhawn Reagent |
| Tel: |
400-400-1332688 18019345275 |
| Email: |
huyue@rhawn.cn |
|
| | Succinic acid-d6 Basic information |
| Product Name: | Succinic acid-d6 | | Synonyms: | SUCCINIC-D4 ACID-D2;BUTANEDIOIC ACID-D6;SUCCINIC-D4 ACID-D2, 98 ATOM % D;Butanedioic-d4 acid-d2;Succinic Acids-d6;Succinic-d6 Acid;Succinic acid-d?;Succinic acid-d6 | | CAS: | 21668-90-6 | | MF: | C4D6O4 | | MW: | 124.13 | | EINECS: | | | Product Categories: | | | Mol File: | 21668-90-6.mol |  |
| | Succinic acid-d6 Chemical Properties |
| Melting point | 187-190 °C(lit.) | | Boiling point | 235 °C | | storage temp. | Store at -20°C | | form | Solid | | color | White to off-white | | InChI | 1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8)/i1D2,2D2/hD2 | | InChIKey | KDYFGRWQOYBRFD-DTDGFSOZSA-N | | SMILES | [2H]OC(=O)C([2H])([2H])C([2H])([2H])C(=O)O[2H] | | CAS Number Unlabeled | 110-15-6 |
| | Succinic acid-d6 Usage And Synthesis |
| Uses | Succinic acid-d6 is the deuterium labeled Succinic acid. Succinic acid is an intermediate product of the tricarboxylic acid cycle, as well as one of fermentation products of anaerobic metabolism. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110
[2] Zhang YJ, et al. Optimization of succinic acid fermentation with Actinobacillus succinogenes by response surface methodology (RSM). J Zhejiang Univ Sci B. 2012 Feb;13(2):103-10. DOI:10.1631/jzus.B1100134 |
| | Succinic acid-d6 Preparation Products And Raw materials |
|