| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-PHENYLISOXAZOLE-3-CARBALDEHYDE Basic information | | Uses |
| | 5-PHENYLISOXAZOLE-3-CARBALDEHYDE Chemical Properties |
| Melting point | 58-62 °C(lit.) | | Boiling point | 361.5±30.0 °C(Predicted) | | density | 1.216±0.06 g/cm3(Predicted) | | form | solid | | pka | -6.25±0.28(Predicted) | | InChI | 1S/C10H7NO2/c12-7-9-6-10(13-11-9)8-4-2-1-3-5-8/h1-7H | | InChIKey | QRHAQXZGSWFBOK-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1cc(on1)-c2ccccc2 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38-42/43 | | Safety Statements | 26-36-45 | | WGK Germany | 2 | | HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | 5-PHENYLISOXAZOLE-3-CARBALDEHYDE Usage And Synthesis |
| Uses | 5-Phenyloxazole-3-carboxaldehyde is an aldehyde derivative that can be used as an organic intermediate. | | Synthesis | 5-Phenylisoxazole-3-carbaldehyde can be prepared from ethyl 5-phenylisoxazole-3-carboxylate by ring closure of ethyl acetylpyruvate with hydrazine hydrate, followed by reduction of the ester group to give (5-phenylisoxazol-3-yl)methanol, and finally oxidation of hydroxyl group to give 5-phenylisoxazole-3-carbaldehyde. |
| | 5-PHENYLISOXAZOLE-3-CARBALDEHYDE Preparation Products And Raw materials |
|