Ethyl 2,4-dioxo-4-phenylbutanoate manufacturers
|
| | Ethyl 2,4-dioxo-4-phenylbutanoate Basic information |
| Product Name: | Ethyl 2,4-dioxo-4-phenylbutanoate | | Synonyms: | 2,4-Dioxo-4-phenyl-butyric acid ethyl ester;Ethyl 4-phenyl-2,4-dioxobutanoate;Benzenebutanoic acid, .alpha.,.gaMMa.-dioxo-, ethyl ester;a,g-Dioxo-benzenebutanoic acid ethyl ester;Ethyl 4-phenyl-2,4-dioxobutanoate 97%;Benzenebutanoic acid, α,γ-dioxo-, ethyl ester;Ethyl 4-phenyl-2,4-dioxobutyrate;Ethyl α,γ-dioxobenzenebutanoate | | CAS: | 6296-54-4 | | MF: | C12H12O4 | | MW: | 220.22 | | EINECS: | | | Product Categories: | C12 to C63;Carbonyl Compounds;Esters;Building Blocks;C12 to C63;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks;other | | Mol File: | 6296-54-4.mol |  |
| | Ethyl 2,4-dioxo-4-phenylbutanoate Chemical Properties |
| Melting point | 36-41 °C | | Boiling point | 167 °C(Press: 5 Torr) | | density | 1.173±0.06 g/cm3(Predicted) | | Fp | 110 °C | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | pka | 6.02±0.23(Predicted) | | color | Yellow | | InChI | InChI=1S/C12H12O4/c1-2-16-12(15)11(14)8-10(13)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 | | InChIKey | UVJQQYMWMAISMQ-UHFFFAOYSA-N | | SMILES | C1(C=CC=CC=1)C(=O)CC(=O)C(=O)OCC |
| WGK Germany | 3 | | HS Code | 2918300090 | | Storage Class | 11 - Combustible Solids |
| | Ethyl 2,4-dioxo-4-phenylbutanoate Usage And Synthesis |
| | Ethyl 2,4-dioxo-4-phenylbutanoate Preparation Products And Raw materials |
|